C24H23N3O4S2 — CID 5009412
N-(4-ethoxy-1,3-benzothiazol-2-yl)-4-[ethyl(phenyl)sulfamoyl]benzamide (PubChem CID 5009412) has the molecular formula C24H23N3O4S2 and a molecular weight of 481.60 g/mol. Its IUPAC name is N-(4-ethoxy-1,3-benzothiazol-2-yl)-4-[ethyl(phenyl)sulfamoyl]benzamide.
| Compound Name | N-(4-ethoxy-1,3-benzothiazol-2-yl)-4-[ethyl(phenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 5009412 |
| Molecular Formula | C24H23N3O4S2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | N-(4-ethoxy-1,3-benzothiazol-2-yl)-4-[ethyl(phenyl)sulfamoyl]benzamide |
| SMILES | CCOc1cccc2sc(NC(=O)c3ccc(S(=O)(=O)N(CC)c4ccccc4)cc3)nc12 |
| InChI | InChI=1S/C24H23N3O4S2/c1-3-27(18-9-6-5-7-10-18)33(29,30)19-15-13-17(14-16-19)23(28)26-24-25-22-20(31-4-2)11-8-12-21(22)32-24/h5-16H,3-4H2,1-2H3,(H,25,26,28) |
| InChIKey | NQADIDGQMSBLQG-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |