C16H15N7OS — CID 125431169
N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]-4-(tetrazol-1-yl)butanamide (PubChem CID 125431169) has the molecular formula C16H15N7OS and a molecular weight of 353.41 g/mol. Its IUPAC name is N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]-4-(tetrazol-1-yl)butanamide.
| Compound Name | N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]-4-(tetrazol-1-yl)butanamide |
|---|---|
| PubChem CID | 125431169 |
| Molecular Formula | C16H15N7OS |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]-4-(tetrazol-1-yl)butanamide |
| SMILES | O=C(CCCn1cnnn1)Nc1nc(-c2c[nH]c3ccccc23)cs1 |
| InChI | InChI=1S/C16H15N7OS/c24-15(6-3-7-23-10-18-21-22-23)20-16-19-14(9-25-16)12-8-17-13-5-2-1-4-11(12)13/h1-2,4-5,8-10,17H,3,6-7H2,(H,19,20,24) |
| InChIKey | PHVBAOOBQDXJRR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |