C21H17N3O6S2 — CID 55538195
[2-(4-methoxyphenyl)-1,3-oxazol-4-yl]methyl 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate (PubChem CID 55538195) has the molecular formula C21H17N3O6S2 and a molecular weight of 471.52 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-1,3-oxazol-4-yl]methyl 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate.
| Compound Name | [2-(4-methoxyphenyl)-1,3-oxazol-4-yl]methyl 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate |
|---|---|
| PubChem CID | 55538195 |
| Molecular Formula | C21H17N3O6S2 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.06 |
| IUPAC Name | [2-(4-methoxyphenyl)-1,3-oxazol-4-yl]methyl 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate |
| SMILES | COc1ccc(-c2nc(COC(=O)c3ccc4c(c3)SC3=NS(=O)(=O)CCN34)co2)cc1 |
| InChI | InChI=1S/C21H17N3O6S2/c1-28-16-5-2-13(3-6-16)19-22-15(11-29-19)12-30-20(25)14-4-7-17-18(10-14)31-21-23-32(26,27)9-8-24(17)21/h2-7,10-11H,8-9,12H2,1H3 |
| InChIKey | YFOTYQCORCYKKV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 111.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |