C21H18N4O6S2 — CID 40795673
[(1S)-1-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]ethyl] 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate (PubChem CID 40795673) has the molecular formula C21H18N4O6S2 and a molecular weight of 486.53 g/mol. Its IUPAC name is [(1S)-1-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]ethyl] 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate.
| Compound Name | [(1S)-1-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]ethyl] 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate |
|---|---|
| PubChem CID | 40795673 |
| Molecular Formula | C21H18N4O6S2 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | [(1S)-1-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]ethyl] 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate |
| SMILES | COc1ccc(-c2nnc([C@H](C)OC(=O)c3ccc4c(c3)SC3=NS(=O)(=O)CCN34)o2)cc1 |
| InChI | InChI=1S/C21H18N4O6S2/c1-12(18-22-23-19(31-18)13-3-6-15(29-2)7-4-13)30-20(26)14-5-8-16-17(11-14)32-21-24-33(27,28)10-9-25(16)21/h3-8,11-12H,9-10H2,1-2H3/t12-/m0/s1 |
| InChIKey | DTZHHARSKFUVAD-LBPRGKRZSA-N |
| XLogP | 3.27 |
| TPSA | 124.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |