C19H13FN4O5S2 — CID 55448123
[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate (PubChem CID 55448123) has the molecular formula C19H13FN4O5S2 and a molecular weight of 460.47 g/mol. Its IUPAC name is [5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate.
| Compound Name | [5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate |
|---|---|
| PubChem CID | 55448123 |
| Molecular Formula | C19H13FN4O5S2 |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.03 |
| IUPAC Name | [5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate |
| SMILES | O=C(OCc1noc(-c2ccc(F)cc2)n1)c1ccc2c(c1)SC1=NS(=O)(=O)CCN12 |
| InChI | InChI=1S/C19H13FN4O5S2/c20-13-4-1-11(2-5-13)17-21-16(22-29-17)10-28-18(25)12-3-6-14-15(9-12)30-19-23-31(26,27)8-7-24(14)19/h1-6,9H,7-8,10H2 |
| InChIKey | AAVDGKZVJAMFKZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 114.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |