C19H19F3N4O6S — CID 29409098
4-methoxy-N'-[2-nitro-4-(trifluoromethyl)phenyl]-3-pyrrolidin-1-ylsulfonylbenzohydrazide (PubChem CID 29409098) has the molecular formula C19H19F3N4O6S and a molecular weight of 488.44 g/mol. Its IUPAC name is 4-methoxy-N'-[2-nitro-4-(trifluoromethyl)phenyl]-3-pyrrolidin-1-ylsulfonylbenzohydrazide.
| Compound Name | 4-methoxy-N'-[2-nitro-4-(trifluoromethyl)phenyl]-3-pyrrolidin-1-ylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 29409098 |
| Molecular Formula | C19H19F3N4O6S |
| Molecular Weight | 488.44 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | 4-methoxy-N'-[2-nitro-4-(trifluoromethyl)phenyl]-3-pyrrolidin-1-ylsulfonylbenzohydrazide |
| SMILES | COc1ccc(C(=O)NNc2ccc(C(F)(F)F)cc2[N+](=O)[O-])cc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C19H19F3N4O6S/c1-32-16-7-4-12(10-17(16)33(30,31)25-8-2-3-9-25)18(27)24-23-14-6-5-13(19(20,21)22)11-15(14)26(28)29/h4-7,10-11,23H,2-3,8-9H2,1H3,(H,24,27) |
| InChIKey | KCFBAGSDFDAJMZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|