C21H23F3N4O5 — CID 55349547
4-ethoxy-N-[3-methyl-1-[2-[2-nitro-4-(trifluoromethyl)phenyl]hydrazinyl]-1-oxobutan-2-yl]benzamide (PubChem CID 55349547) has the molecular formula C21H23F3N4O5 and a molecular weight of 468.43 g/mol. Its IUPAC name is 4-ethoxy-N-[3-methyl-1-[2-[2-nitro-4-(trifluoromethyl)phenyl]hydrazinyl]-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-ethoxy-N-[3-methyl-1-[2-[2-nitro-4-(trifluoromethyl)phenyl]hydrazinyl]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 55349547 |
| Molecular Formula | C21H23F3N4O5 |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 4-ethoxy-N-[3-methyl-1-[2-[2-nitro-4-(trifluoromethyl)phenyl]hydrazinyl]-1-oxobutan-2-yl]benzamide |
| SMILES | CCOc1ccc(C(=O)NC(C(=O)NNc2ccc(C(F)(F)F)cc2[N+](=O)[O-])C(C)C)cc1 |
| InChI | InChI=1S/C21H23F3N4O5/c1-4-33-15-8-5-13(6-9-15)19(29)25-18(12(2)3)20(30)27-26-16-10-7-14(21(22,23)24)11-17(16)28(31)32/h5-12,18,26H,4H2,1-3H3,(H,25,29)(H,27,30) |
| InChIKey | DQOQKDRNICYSBF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|