C19H15Cl2F3N4O4 — CID 55631589
1-(2,5-dichlorobenzoyl)-N'-[2-nitro-4-(trifluoromethyl)phenyl]pyrrolidine-2-carbohydrazide (PubChem CID 55631589) has the molecular formula C19H15Cl2F3N4O4 and a molecular weight of 491.25 g/mol. Its IUPAC name is 1-(2,5-dichlorobenzoyl)-N'-[2-nitro-4-(trifluoromethyl)phenyl]pyrrolidine-2-carbohydrazide.
| Compound Name | 1-(2,5-dichlorobenzoyl)-N'-[2-nitro-4-(trifluoromethyl)phenyl]pyrrolidine-2-carbohydrazide |
|---|---|
| PubChem CID | 55631589 |
| Molecular Formula | C19H15Cl2F3N4O4 |
| Molecular Weight | 491.25 g/mol |
| Exact Mass | 490.04 |
| IUPAC Name | 1-(2,5-dichlorobenzoyl)-N'-[2-nitro-4-(trifluoromethyl)phenyl]pyrrolidine-2-carbohydrazide |
| SMILES | O=C(NNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])C1CCCN1C(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C19H15Cl2F3N4O4/c20-11-4-5-13(21)12(9-11)18(30)27-7-1-2-15(27)17(29)26-25-14-6-3-10(19(22,23)24)8-16(14)28(31)32/h3-6,8-9,15,25H,1-2,7H2,(H,26,29) |
| InChIKey | LHYIGRXQJUJMAG-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.25 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|