C18H19Cl2N5O2 — CID 51938469
(2R)-1-(2,5-dichlorobenzoyl)-N'-(4,6-dimethylpyrimidin-2-yl)pyrrolidine-2-carbohydrazide (PubChem CID 51938469) has the molecular formula C18H19Cl2N5O2 and a molecular weight of 408.29 g/mol. Its IUPAC name is (2R)-1-(2,5-dichlorobenzoyl)-N'-(4,6-dimethylpyrimidin-2-yl)pyrrolidine-2-carbohydrazide.
| Compound Name | (2R)-1-(2,5-dichlorobenzoyl)-N'-(4,6-dimethylpyrimidin-2-yl)pyrrolidine-2-carbohydrazide |
|---|---|
| PubChem CID | 51938469 |
| Molecular Formula | C18H19Cl2N5O2 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | (2R)-1-(2,5-dichlorobenzoyl)-N'-(4,6-dimethylpyrimidin-2-yl)pyrrolidine-2-carbohydrazide |
| SMILES | Cc1cc(C)nc(NNC(=O)[C@H]2CCCN2C(=O)c2cc(Cl)ccc2Cl)n1 |
| InChI | InChI=1S/C18H19Cl2N5O2/c1-10-8-11(2)22-18(21-10)24-23-16(26)15-4-3-7-25(15)17(27)13-9-12(19)5-6-14(13)20/h5-6,8-9,15H,3-4,7H2,1-2H3,(H,23,26)(H,21,22,24)/t15-/m1/s1 |
| InChIKey | BBWSFLXQWZWCPL-OAHLLOKOSA-N |
| XLogP | 3.15 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|