C20H20Cl2N2O3 — CID 55780335
1-(2,5-dichlorobenzoyl)-N-[2-(methoxymethyl)phenyl]pyrrolidine-2-carboxamide (PubChem CID 55780335) has the molecular formula C20H20Cl2N2O3 and a molecular weight of 407.30 g/mol. Its IUPAC name is 1-(2,5-dichlorobenzoyl)-N-[2-(methoxymethyl)phenyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-(2,5-dichlorobenzoyl)-N-[2-(methoxymethyl)phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 55780335 |
| Molecular Formula | C20H20Cl2N2O3 |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 1-(2,5-dichlorobenzoyl)-N-[2-(methoxymethyl)phenyl]pyrrolidine-2-carboxamide |
| SMILES | COCc1ccccc1NC(=O)C1CCCN1C(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C20H20Cl2N2O3/c1-27-12-13-5-2-3-6-17(13)23-19(25)18-7-4-10-24(18)20(26)15-11-14(21)8-9-16(15)22/h2-3,5-6,8-9,11,18H,4,7,10,12H2,1H3,(H,23,25) |
| InChIKey | GEILPZDFDAPCJJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |