C21H20Cl2N2O4 — CID 55607238
ethyl 3-[[1-(2,5-dichlorobenzoyl)pyrrolidine-2-carbonyl]amino]benzoate (PubChem CID 55607238) has the molecular formula C21H20Cl2N2O4 and a molecular weight of 435.31 g/mol. Its IUPAC name is ethyl 3-[[1-(2,5-dichlorobenzoyl)pyrrolidine-2-carbonyl]amino]benzoate.
| Compound Name | ethyl 3-[[1-(2,5-dichlorobenzoyl)pyrrolidine-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 55607238 |
| Molecular Formula | C21H20Cl2N2O4 |
| Molecular Weight | 435.31 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | ethyl 3-[[1-(2,5-dichlorobenzoyl)pyrrolidine-2-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)C2CCCN2C(=O)c2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C21H20Cl2N2O4/c1-2-29-21(28)13-5-3-6-15(11-13)24-19(26)18-7-4-10-25(18)20(27)16-12-14(22)8-9-17(16)23/h3,5-6,8-9,11-12,18H,2,4,7,10H2,1H3,(H,24,26) |
| InChIKey | USELMVZQLFPGLI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.31 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |