C18H19F3N4O5S2 — CID 55526739
1-(5-methylthiophen-2-yl)sulfonyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-3-carbohydrazide (PubChem CID 55526739) has the molecular formula C18H19F3N4O5S2 and a molecular weight of 492.50 g/mol. Its IUPAC name is 1-(5-methylthiophen-2-yl)sulfonyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-3-carbohydrazide.
| Compound Name | 1-(5-methylthiophen-2-yl)sulfonyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-3-carbohydrazide |
|---|---|
| PubChem CID | 55526739 |
| Molecular Formula | C18H19F3N4O5S2 |
| Molecular Weight | 492.50 g/mol |
| Exact Mass | 492.07 |
| IUPAC Name | 1-(5-methylthiophen-2-yl)sulfonyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-3-carbohydrazide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC(C(=O)NNc3ccc(C(F)(F)F)cc3[N+](=O)[O-])C2)s1 |
| InChI | InChI=1S/C18H19F3N4O5S2/c1-11-4-7-16(31-11)32(29,30)24-8-2-3-12(10-24)17(26)23-22-14-6-5-13(18(19,20)21)9-15(14)25(27)28/h4-7,9,12,22H,2-3,8,10H2,1H3,(H,23,26) |
| InChIKey | GVNDKTKFFSQZDH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|