C20H18F3N5O5 — CID 41263056
1-ethyl-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]-2,3-dioxo-4H-quinoxaline-6-carboxamide (PubChem CID 41263056) has the molecular formula C20H18F3N5O5 and a molecular weight of 465.39 g/mol. Its IUPAC name is 1-ethyl-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]-2,3-dioxo-4H-quinoxaline-6-carboxamide.
| Compound Name | 1-ethyl-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]-2,3-dioxo-4H-quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 41263056 |
| Molecular Formula | C20H18F3N5O5 |
| Molecular Weight | 465.39 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | 1-ethyl-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]-2,3-dioxo-4H-quinoxaline-6-carboxamide |
| SMILES | CCn1c(=O)c(=O)[nH]c2cc(C(=O)NCCNc3ccc(C(F)(F)F)cc3[N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C20H18F3N5O5/c1-2-27-15-6-3-11(9-14(15)26-18(30)19(27)31)17(29)25-8-7-24-13-5-4-12(20(21,22)23)10-16(13)28(32)33/h3-6,9-10,24H,2,7-8H2,1H3,(H,25,29)(H,26,30) |
| InChIKey | WGQPVPFKCVUSLH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 139.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|