C19H14F3N3O7 — CID 27705664
[2-[2-nitro-4-(trifluoromethyl)anilino]-2-oxoethyl] 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate (PubChem CID 27705664) has the molecular formula C19H14F3N3O7 and a molecular weight of 453.33 g/mol. Its IUPAC name is [2-[2-nitro-4-(trifluoromethyl)anilino]-2-oxoethyl] 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate.
| Compound Name | [2-[2-nitro-4-(trifluoromethyl)anilino]-2-oxoethyl] 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate |
|---|---|
| PubChem CID | 27705664 |
| Molecular Formula | C19H14F3N3O7 |
| Molecular Weight | 453.33 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | [2-[2-nitro-4-(trifluoromethyl)anilino]-2-oxoethyl] 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate |
| SMILES | O=C(COC(=O)CCn1c(=O)oc2ccccc21)Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H14F3N3O7/c20-19(21,22)11-5-6-12(14(9-11)25(29)30)23-16(26)10-31-17(27)7-8-24-13-3-1-2-4-15(13)32-18(24)28/h1-6,9H,7-8,10H2,(H,23,26) |
| InChIKey | IGEHMCJJJLFMDO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|