C18H18F3N3O6S — CID 27664660
N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonamide (PubChem CID 27664660) has the molecular formula C18H18F3N3O6S and a molecular weight of 461.42 g/mol. Its IUPAC name is N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonamide.
| Compound Name | N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonamide |
|---|---|
| PubChem CID | 27664660 |
| Molecular Formula | C18H18F3N3O6S |
| Molecular Weight | 461.42 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonamide |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1NCCNS(=O)(=O)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C18H18F3N3O6S/c19-18(20,21)12-2-4-14(15(10-12)24(25)26)22-6-7-23-31(27,28)13-3-5-16-17(11-13)30-9-1-8-29-16/h2-5,10-11,22-23H,1,6-9H2 |
| InChIKey | HZSBILOVACSQRI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|