C21H18N6O3 — CID 18208128
[4-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)methylamino]-3-nitrophenyl]-phenylmethanone (PubChem CID 18208128) has the molecular formula C21H18N6O3 and a molecular weight of 402.41 g/mol. Its IUPAC name is [4-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)methylamino]-3-nitrophenyl]-phenylmethanone.
| Compound Name | [4-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)methylamino]-3-nitrophenyl]-phenylmethanone |
|---|---|
| PubChem CID | 18208128 |
| Molecular Formula | C21H18N6O3 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | [4-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)methylamino]-3-nitrophenyl]-phenylmethanone |
| SMILES | Cc1cc(C)n2c(CNc3ccc(C(=O)c4ccccc4)cc3[N+](=O)[O-])nnc2n1 |
| InChI | InChI=1S/C21H18N6O3/c1-13-10-14(2)26-19(24-25-21(26)23-13)12-22-17-9-8-16(11-18(17)27(29)30)20(28)15-6-4-3-5-7-15/h3-11,22H,12H2,1-2H3 |
| InChIKey | QXEJPFXBLJTUBW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|