C17H12N6O4S — CID 166203005
4-nitro-N-[1-(5-phenyl-1,2,4-oxadiazol-3-yl)ethyl]-2,1,3-benzothiadiazole-6-carboxamide (PubChem CID 166203005) has the molecular formula C17H12N6O4S and a molecular weight of 396.39 g/mol. Its IUPAC name is 4-nitro-N-[1-(5-phenyl-1,2,4-oxadiazol-3-yl)ethyl]-2,1,3-benzothiadiazole-6-carboxamide.
| Compound Name | 4-nitro-N-[1-(5-phenyl-1,2,4-oxadiazol-3-yl)ethyl]-2,1,3-benzothiadiazole-6-carboxamide |
|---|---|
| PubChem CID | 166203005 |
| Molecular Formula | C17H12N6O4S |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 4-nitro-N-[1-(5-phenyl-1,2,4-oxadiazol-3-yl)ethyl]-2,1,3-benzothiadiazole-6-carboxamide |
| SMILES | CC(NC(=O)c1cc([N+](=O)[O-])c2nsnc2c1)c1noc(-c2ccccc2)n1 |
| InChI | InChI=1S/C17H12N6O4S/c1-9(15-19-17(27-20-15)10-5-3-2-4-6-10)18-16(24)11-7-12-14(22-28-21-12)13(8-11)23(25)26/h2-9H,1H3,(H,18,24) |
| InChIKey | PGDIDKDDYUGONB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 136.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|