C10H13ClN4O4S — CID 133304647
N-[1-(3-chloro-5-nitro-2-pyridinyl)pyrrolidin-3-yl]methanesulfonamide (PubChem CID 133304647) has the molecular formula C10H13ClN4O4S and a molecular weight of 320.76 g/mol. Its IUPAC name is N-[1-(3-chloro-5-nitro-2-pyridinyl)pyrrolidin-3-yl]methanesulfonamide.
| Compound Name | N-[1-(3-chloro-5-nitro-2-pyridinyl)pyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 133304647 |
| Molecular Formula | C10H13ClN4O4S |
| Molecular Weight | 320.76 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | N-[1-(3-chloro-5-nitro-2-pyridinyl)pyrrolidin-3-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC1CCN(c2ncc([N+](=O)[O-])cc2Cl)C1 |
| InChI | InChI=1S/C10H13ClN4O4S/c1-20(18,19)13-7-2-3-14(6-7)10-9(11)4-8(5-12-10)15(16)17/h4-5,7,13H,2-3,6H2,1H3 |
| InChIKey | BMARKESJMUGXAX-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.76 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|