C14H17ClN6O2S — CID 133309442
3-[1-(3-chloro-5-nitro-2-pyridinyl)piperidin-4-yl]-4-ethyl-1H-1,2,4-triazole-5-thione (PubChem CID 133309442) has the molecular formula C14H17ClN6O2S and a molecular weight of 368.85 g/mol. Its IUPAC name is 3-[1-(3-chloro-5-nitro-2-pyridinyl)piperidin-4-yl]-4-ethyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[1-(3-chloro-5-nitro-2-pyridinyl)piperidin-4-yl]-4-ethyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 133309442 |
| Molecular Formula | C14H17ClN6O2S |
| Molecular Weight | 368.85 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 3-[1-(3-chloro-5-nitro-2-pyridinyl)piperidin-4-yl]-4-ethyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCn1c(C2CCN(c3ncc([N+](=O)[O-])cc3Cl)CC2)n[nH]c1=S |
| InChI | InChI=1S/C14H17ClN6O2S/c1-2-20-12(17-18-14(20)24)9-3-5-19(6-4-9)13-11(15)7-10(8-16-13)21(22)23/h7-9H,2-6H2,1H3,(H,18,24) |
| InChIKey | SVZRUDPRFXYWAB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 92.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.85 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|