C13H15ClN6O3 — CID 133374917
4-(3-chloro-5-nitro-2-pyridinyl)-2-(5-ethyl-1H-1,2,4-triazol-3-yl)morpholine (PubChem CID 133374917) has the molecular formula C13H15ClN6O3 and a molecular weight of 338.76 g/mol. Its IUPAC name is 4-(3-chloro-5-nitro-2-pyridinyl)-2-(5-ethyl-1H-1,2,4-triazol-3-yl)morpholine.
| Compound Name | 4-(3-chloro-5-nitro-2-pyridinyl)-2-(5-ethyl-1H-1,2,4-triazol-3-yl)morpholine |
|---|---|
| PubChem CID | 133374917 |
| Molecular Formula | C13H15ClN6O3 |
| Molecular Weight | 338.76 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 4-(3-chloro-5-nitro-2-pyridinyl)-2-(5-ethyl-1H-1,2,4-triazol-3-yl)morpholine |
| SMILES | CCc1nc(C2CN(c3ncc([N+](=O)[O-])cc3Cl)CCO2)n[nH]1 |
| InChI | InChI=1S/C13H15ClN6O3/c1-2-11-16-12(18-17-11)10-7-19(3-4-23-10)13-9(14)5-8(6-15-13)20(21)22/h5-6,10H,2-4,7H2,1H3,(H,16,17,18) |
| InChIKey | RRMBPIBMNOOZGB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 110.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.76 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|