C20H31IN4O4S — CID 111555840
N-(1,1-dioxothiolan-3-yl)-3-[[N-ethyl-N'-[(2-prop-2-enoxyphenyl)methyl]carbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 111555840) has the molecular formula C20H31IN4O4S and a molecular weight of 550.46 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-[[N-ethyl-N'-[(2-prop-2-enoxyphenyl)methyl]carbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-[[N-ethyl-N'-[(2-prop-2-enoxyphenyl)methyl]carbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111555840 |
| Molecular Formula | C20H31IN4O4S |
| Molecular Weight | 550.46 g/mol |
| Exact Mass | 550.11 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-[[N-ethyl-N'-[(2-prop-2-enoxyphenyl)methyl]carbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | C=CCOc1ccccc1C/N=C(\NCC)NCCC(=O)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C20H30N4O4S.HI/c1-3-12-28-18-8-6-5-7-16(18)14-23-20(21-4-2)22-11-9-19(25)24-17-10-13-29(26,27)15-17;/h3,5-8,17H,1,4,9-15H2,2H3,(H,24,25)(H2,21,22,23);1H |
| InChIKey | PWGGAWXIEOVSNX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.46 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|