C19H31BrN4O3 — CID 111406385
3-bromo-N-[3-[[ethylamino-[3-(2-methoxyethoxy)propylamino]methylidene]amino]propyl]benzamide (PubChem CID 111406385) has the molecular formula C19H31BrN4O3 and a molecular weight of 443.39 g/mol. Its IUPAC name is 3-bromo-N-[3-[[ethylamino-[3-(2-methoxyethoxy)propylamino]methylidene]amino]propyl]benzamide.
| Compound Name | 3-bromo-N-[3-[[ethylamino-[3-(2-methoxyethoxy)propylamino]methylidene]amino]propyl]benzamide |
|---|---|
| PubChem CID | 111406385 |
| Molecular Formula | C19H31BrN4O3 |
| Molecular Weight | 443.39 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 3-bromo-N-[3-[[ethylamino-[3-(2-methoxyethoxy)propylamino]methylidene]amino]propyl]benzamide |
| SMILES | CCN/C(=N\CCCNC(=O)c1cccc(Br)c1)NCCCOCCOC |
| InChI | InChI=1S/C19H31BrN4O3/c1-3-21-19(24-11-6-12-27-14-13-26-2)23-10-5-9-22-18(25)16-7-4-8-17(20)15-16/h4,7-8,15H,3,5-6,9-14H2,1-2H3,(H,22,25)(H2,21,23,24) |
| InChIKey | CVNOZWJSAQVMCV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|