C19H32BrIN4O3 — CID 111692915
3-bromo-N-[2-[[N-[2-(2-butoxyethoxy)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide (PubChem CID 111692915) has the molecular formula C19H32BrIN4O3 and a molecular weight of 571.30 g/mol. Its IUPAC name is 3-bromo-N-[2-[[N-[2-(2-butoxyethoxy)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide.
| Compound Name | 3-bromo-N-[2-[[N-[2-(2-butoxyethoxy)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111692915 |
| Molecular Formula | C19H32BrIN4O3 |
| Molecular Weight | 571.30 g/mol |
| Exact Mass | 570.07 |
| IUPAC Name | 3-bromo-N-[2-[[N-[2-(2-butoxyethoxy)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide |
| SMILES | CCCCOCCOCCN/C(=N\C)NCCNC(=O)c1cccc(Br)c1.I |
| InChI | InChI=1S/C19H31BrN4O3.HI/c1-3-4-11-26-13-14-27-12-10-24-19(21-2)23-9-8-22-18(25)16-6-5-7-17(20)15-16;/h5-7,15H,3-4,8-14H2,1-2H3,(H,22,25)(H2,21,23,24);1H |
| InChIKey | WYACCTXUSIQZGA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|