C17H27BrN4O — CID 111128775
3-bromo-N-[3-[(N'-methyl-N-pentylcarbamimidoyl)amino]propyl]benzamide (PubChem CID 111128775) has the molecular formula C17H27BrN4O and a molecular weight of 383.33 g/mol. Its IUPAC name is 3-bromo-N-[3-[(N'-methyl-N-pentylcarbamimidoyl)amino]propyl]benzamide.
| Compound Name | 3-bromo-N-[3-[(N'-methyl-N-pentylcarbamimidoyl)amino]propyl]benzamide |
|---|---|
| PubChem CID | 111128775 |
| Molecular Formula | C17H27BrN4O |
| Molecular Weight | 383.33 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 3-bromo-N-[3-[(N'-methyl-N-pentylcarbamimidoyl)amino]propyl]benzamide |
| SMILES | CCCCCN/C(=N\C)NCCCNC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C17H27BrN4O/c1-3-4-5-10-21-17(19-2)22-12-7-11-20-16(23)14-8-6-9-15(18)13-14/h6,8-9,13H,3-5,7,10-12H2,1-2H3,(H,20,23)(H2,19,21,22) |
| InChIKey | SDLUSGOXPBEZLX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|