C18H29BrN4O2 — CID 111971956
3-bromo-N-[2-[[N'-methyl-N-[2-(3-methylbutoxy)ethyl]carbamimidoyl]amino]ethyl]benzamide (PubChem CID 111971956) has the molecular formula C18H29BrN4O2 and a molecular weight of 413.36 g/mol. Its IUPAC name is 3-bromo-N-[2-[[N'-methyl-N-[2-(3-methylbutoxy)ethyl]carbamimidoyl]amino]ethyl]benzamide.
| Compound Name | 3-bromo-N-[2-[[N'-methyl-N-[2-(3-methylbutoxy)ethyl]carbamimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 111971956 |
| Molecular Formula | C18H29BrN4O2 |
| Molecular Weight | 413.36 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 3-bromo-N-[2-[[N'-methyl-N-[2-(3-methylbutoxy)ethyl]carbamimidoyl]amino]ethyl]benzamide |
| SMILES | C/N=C(/NCCNC(=O)c1cccc(Br)c1)NCCOCCC(C)C |
| InChI | InChI=1S/C18H29BrN4O2/c1-14(2)7-11-25-12-10-23-18(20-3)22-9-8-21-17(24)15-5-4-6-16(19)13-15/h4-6,13-14H,7-12H2,1-3H3,(H,21,24)(H2,20,22,23) |
| InChIKey | OJHVDZPLKPAIDT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|