C20H34N4O3 — CID 111240135
N-[2-[[N'-(3-butoxypropyl)-N-ethylcarbamimidoyl]amino]ethyl]-3-methoxybenzamide (PubChem CID 111240135) has the molecular formula C20H34N4O3 and a molecular weight of 378.52 g/mol. Its IUPAC name is N-[2-[[N'-(3-butoxypropyl)-N-ethylcarbamimidoyl]amino]ethyl]-3-methoxybenzamide.
| Compound Name | N-[2-[[N'-(3-butoxypropyl)-N-ethylcarbamimidoyl]amino]ethyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 111240135 |
| Molecular Formula | C20H34N4O3 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | N-[2-[[N'-(3-butoxypropyl)-N-ethylcarbamimidoyl]amino]ethyl]-3-methoxybenzamide |
| SMILES | CCCCOCCC/N=C(\NCC)NCCNC(=O)c1cccc(OC)c1 |
| InChI | InChI=1S/C20H34N4O3/c1-4-6-14-27-15-8-11-23-20(21-5-2)24-13-12-22-19(25)17-9-7-10-18(16-17)26-3/h7,9-10,16H,4-6,8,11-15H2,1-3H3,(H,22,25)(H2,21,23,24) |
| InChIKey | NQZBJZLFDYJHMA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|