C22H37IN4O4 — CID 111644953
N-[2-[[N-ethyl-N'-[3-(oxan-4-ylmethoxy)propyl]carbamimidoyl]amino]ethyl]-3-methoxybenzamide;hydroiodide (PubChem CID 111644953) has the molecular formula C22H37IN4O4 and a molecular weight of 548.47 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[3-(oxan-4-ylmethoxy)propyl]carbamimidoyl]amino]ethyl]-3-methoxybenzamide;hydroiodide.
| Compound Name | N-[2-[[N-ethyl-N'-[3-(oxan-4-ylmethoxy)propyl]carbamimidoyl]amino]ethyl]-3-methoxybenzamide;hydroiodide |
|---|---|
| PubChem CID | 111644953 |
| Molecular Formula | C22H37IN4O4 |
| Molecular Weight | 548.47 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[3-(oxan-4-ylmethoxy)propyl]carbamimidoyl]amino]ethyl]-3-methoxybenzamide;hydroiodide |
| SMILES | CCN/C(=N\CCCOCC1CCOCC1)NCCNC(=O)c1cccc(OC)c1.I |
| InChI | InChI=1S/C22H36N4O4.HI/c1-3-23-22(25-10-5-13-30-17-18-8-14-29-15-9-18)26-12-11-24-21(27)19-6-4-7-20(16-19)28-2;/h4,6-7,16,18H,3,5,8-15,17H2,1-2H3,(H,24,27)(H2,23,25,26);1H |
| InChIKey | SFTGXCGQJXAOOB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.47 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|