C18H30BrN3O2 — CID 111768697
2-[3-(3-bromophenyl)propyl]-1-ethyl-3-[3-(2-methoxyethoxy)propyl]guanidine (PubChem CID 111768697) has the molecular formula C18H30BrN3O2 and a molecular weight of 400.36 g/mol. Its IUPAC name is 2-[3-(3-bromophenyl)propyl]-1-ethyl-3-[3-(2-methoxyethoxy)propyl]guanidine.
| Compound Name | 2-[3-(3-bromophenyl)propyl]-1-ethyl-3-[3-(2-methoxyethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111768697 |
| Molecular Formula | C18H30BrN3O2 |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 2-[3-(3-bromophenyl)propyl]-1-ethyl-3-[3-(2-methoxyethoxy)propyl]guanidine |
| SMILES | CCN/C(=N\CCCc1cccc(Br)c1)NCCCOCCOC |
| InChI | InChI=1S/C18H30BrN3O2/c1-3-20-18(22-11-6-12-24-14-13-23-2)21-10-5-8-16-7-4-9-17(19)15-16/h4,7,9,15H,3,5-6,8,10-14H2,1-2H3,(H2,20,21,22) |
| InChIKey | VCVFGZREYQBORU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|