C19H24N3O2S+ — CID 8557506
1-[2-oxo-2-[[(S)-phenyl(thiophen-2-yl)methyl]amino]ethyl]piperidin-1-ium-4-carboxamide (PubChem CID 8557506) has the molecular formula C19H24N3O2S+ and a molecular weight of 358.49 g/mol. Its IUPAC name is 1-[2-oxo-2-[[(S)-phenyl(thiophen-2-yl)methyl]amino]ethyl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[2-oxo-2-[[(S)-phenyl(thiophen-2-yl)methyl]amino]ethyl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 8557506 |
| Molecular Formula | C19H24N3O2S+ |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 1-[2-oxo-2-[[(S)-phenyl(thiophen-2-yl)methyl]amino]ethyl]piperidin-1-ium-4-carboxamide |
| SMILES | NC(=O)C1CC[NH+](CC(=O)N[C@@H](c2ccccc2)c2cccs2)CC1 |
| InChI | InChI=1S/C19H23N3O2S/c20-19(24)15-8-10-22(11-9-15)13-17(23)21-18(16-7-4-12-25-16)14-5-2-1-3-6-14/h1-7,12,15,18H,8-11,13H2,(H2,20,24)(H,21,23)/p+1/t18-/m0/s1 |
| InChIKey | VNOFVSOAYLNQNN-SFHVURJKSA-O |
| XLogP | 0.73 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |