C18H15FN2OS2 — CID 9347590
N-[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]-2-pyridin-2-ylsulfanylacetamide (PubChem CID 9347590) has the molecular formula C18H15FN2OS2 and a molecular weight of 358.46 g/mol. Its IUPAC name is N-[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]-2-pyridin-2-ylsulfanylacetamide.
| Compound Name | N-[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]-2-pyridin-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 9347590 |
| Molecular Formula | C18H15FN2OS2 |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | N-[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]-2-pyridin-2-ylsulfanylacetamide |
| SMILES | O=C(CSc1ccccn1)N[C@H](c1ccc(F)cc1)c1cccs1 |
| InChI | InChI=1S/C18H15FN2OS2/c19-14-8-6-13(7-9-14)18(15-4-3-11-23-15)21-16(22)12-24-17-5-1-2-10-20-17/h1-11,18H,12H2,(H,21,22)/t18-/m1/s1 |
| InChIKey | QHWQUSIUXJPQKB-GOSISDBHSA-N |
| XLogP | 4.28 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |