C23H31NO6 — CID 90623404
3,4,5-triethoxy-N-[2-methoxy-2-(3-methoxyphenyl)ethyl]benzamide (PubChem CID 90623404) has the molecular formula C23H31NO6 and a molecular weight of 417.50 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[2-methoxy-2-(3-methoxyphenyl)ethyl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[2-methoxy-2-(3-methoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 90623404 |
| Molecular Formula | C23H31NO6 |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 3,4,5-triethoxy-N-[2-methoxy-2-(3-methoxyphenyl)ethyl]benzamide |
| SMILES | CCOc1cc(C(=O)NCC(OC)c2cccc(OC)c2)cc(OCC)c1OCC |
| InChI | InChI=1S/C23H31NO6/c1-6-28-19-13-17(14-20(29-7-2)22(19)30-8-3)23(25)24-15-21(27-5)16-10-9-11-18(12-16)26-4/h9-14,21H,6-8,15H2,1-5H3,(H,24,25) |
| InChIKey | ZGLIJWFMTMVCEE-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |