C17H17BrClNO3 — CID 90623399
5-bromo-2-chloro-N-[2-methoxy-2-(3-methoxyphenyl)ethyl]benzamide (PubChem CID 90623399) has the molecular formula C17H17BrClNO3 and a molecular weight of 398.68 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[2-methoxy-2-(3-methoxyphenyl)ethyl]benzamide.
| Compound Name | 5-bromo-2-chloro-N-[2-methoxy-2-(3-methoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 90623399 |
| Molecular Formula | C17H17BrClNO3 |
| Molecular Weight | 398.68 g/mol |
| Exact Mass | 397.01 |
| IUPAC Name | 5-bromo-2-chloro-N-[2-methoxy-2-(3-methoxyphenyl)ethyl]benzamide |
| SMILES | COc1cccc(C(CNC(=O)c2cc(Br)ccc2Cl)OC)c1 |
| InChI | InChI=1S/C17H17BrClNO3/c1-22-13-5-3-4-11(8-13)16(23-2)10-20-17(21)14-9-12(18)6-7-15(14)19/h3-9,16H,10H2,1-2H3,(H,20,21) |
| InChIKey | RVPKPQLPSWIERV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.68 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |