C14H12BrCl2NO2S — CID 121180187
5-bromo-2-chloro-N-[2-(5-chlorothiophen-2-yl)-2-methoxyethyl]benzamide (PubChem CID 121180187) has the molecular formula C14H12BrCl2NO2S and a molecular weight of 409.13 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[2-(5-chlorothiophen-2-yl)-2-methoxyethyl]benzamide.
| Compound Name | 5-bromo-2-chloro-N-[2-(5-chlorothiophen-2-yl)-2-methoxyethyl]benzamide |
|---|---|
| PubChem CID | 121180187 |
| Molecular Formula | C14H12BrCl2NO2S |
| Molecular Weight | 409.13 g/mol |
| Exact Mass | 406.91 |
| IUPAC Name | 5-bromo-2-chloro-N-[2-(5-chlorothiophen-2-yl)-2-methoxyethyl]benzamide |
| SMILES | COC(CNC(=O)c1cc(Br)ccc1Cl)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H12BrCl2NO2S/c1-20-11(12-4-5-13(17)21-12)7-18-14(19)9-6-8(15)2-3-10(9)16/h2-6,11H,7H2,1H3,(H,18,19) |
| InChIKey | QVFUQTKFFSJDSN-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.13 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |