C14H12Cl2N2O4S — CID 121180166
2-chloro-N-[2-(5-chlorothiophen-2-yl)-2-methoxyethyl]-5-nitrobenzamide (PubChem CID 121180166) has the molecular formula C14H12Cl2N2O4S and a molecular weight of 375.23 g/mol. Its IUPAC name is 2-chloro-N-[2-(5-chlorothiophen-2-yl)-2-methoxyethyl]-5-nitrobenzamide.
| Compound Name | 2-chloro-N-[2-(5-chlorothiophen-2-yl)-2-methoxyethyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 121180166 |
| Molecular Formula | C14H12Cl2N2O4S |
| Molecular Weight | 375.23 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | 2-chloro-N-[2-(5-chlorothiophen-2-yl)-2-methoxyethyl]-5-nitrobenzamide |
| SMILES | COC(CNC(=O)c1cc([N+](=O)[O-])ccc1Cl)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H12Cl2N2O4S/c1-22-11(12-4-5-13(16)23-12)7-17-14(19)9-6-8(18(20)21)2-3-10(9)15/h2-6,11H,7H2,1H3,(H,17,19) |
| InChIKey | AIFWRGVUVBBALO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.23 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|