C18H19ClN2O5 — CID 90536446
2-chloro-N-[2-(2-hydroxyethoxy)-2-(4-methylphenyl)ethyl]-5-nitrobenzamide (PubChem CID 90536446) has the molecular formula C18H19ClN2O5 and a molecular weight of 378.81 g/mol. Its IUPAC name is 2-chloro-N-[2-(2-hydroxyethoxy)-2-(4-methylphenyl)ethyl]-5-nitrobenzamide.
| Compound Name | 2-chloro-N-[2-(2-hydroxyethoxy)-2-(4-methylphenyl)ethyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 90536446 |
| Molecular Formula | C18H19ClN2O5 |
| Molecular Weight | 378.81 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 2-chloro-N-[2-(2-hydroxyethoxy)-2-(4-methylphenyl)ethyl]-5-nitrobenzamide |
| SMILES | Cc1ccc(C(CNC(=O)c2cc([N+](=O)[O-])ccc2Cl)OCCO)cc1 |
| InChI | InChI=1S/C18H19ClN2O5/c1-12-2-4-13(5-3-12)17(26-9-8-22)11-20-18(23)15-10-14(21(24)25)6-7-16(15)19/h2-7,10,17,22H,8-9,11H2,1H3,(H,20,23) |
| InChIKey | QFJKSHKEYHIMFO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.81 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|