C13H14ClNO2S2 — CID 90598345
5-chloro-N-[2-methoxy-2-(5-methylthiophen-2-yl)ethyl]thiophene-2-carboxamide (PubChem CID 90598345) has the molecular formula C13H14ClNO2S2 and a molecular weight of 315.85 g/mol. Its IUPAC name is 5-chloro-N-[2-methoxy-2-(5-methylthiophen-2-yl)ethyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[2-methoxy-2-(5-methylthiophen-2-yl)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 90598345 |
| Molecular Formula | C13H14ClNO2S2 |
| Molecular Weight | 315.85 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | 5-chloro-N-[2-methoxy-2-(5-methylthiophen-2-yl)ethyl]thiophene-2-carboxamide |
| SMILES | COC(CNC(=O)c1ccc(Cl)s1)c1ccc(C)s1 |
| InChI | InChI=1S/C13H14ClNO2S2/c1-8-3-4-10(18-8)9(17-2)7-15-13(16)11-5-6-12(14)19-11/h3-6,9H,7H2,1-2H3,(H,15,16) |
| InChIKey | ISTMVSUDCAPQPD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.85 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |