C12H15N3O2S2 — CID 97417384
N-[(2S)-2-methoxy-2-(5-methylthiophen-2-yl)ethyl]-4-methylthiadiazole-5-carboxamide (PubChem CID 97417384) has the molecular formula C12H15N3O2S2 and a molecular weight of 297.41 g/mol. Its IUPAC name is N-[(2S)-2-methoxy-2-(5-methylthiophen-2-yl)ethyl]-4-methylthiadiazole-5-carboxamide.
| Compound Name | N-[(2S)-2-methoxy-2-(5-methylthiophen-2-yl)ethyl]-4-methylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 97417384 |
| Molecular Formula | C12H15N3O2S2 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | N-[(2S)-2-methoxy-2-(5-methylthiophen-2-yl)ethyl]-4-methylthiadiazole-5-carboxamide |
| SMILES | CO[C@@H](CNC(=O)c1snnc1C)c1ccc(C)s1 |
| InChI | InChI=1S/C12H15N3O2S2/c1-7-4-5-10(18-7)9(17-3)6-13-12(16)11-8(2)14-15-19-11/h4-5,9H,6H2,1-3H3,(H,13,16)/t9-/m0/s1 |
| InChIKey | IHSWAQGSDXIBCZ-VIFPVBQESA-N |
| XLogP | 2.33 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |