C12H9Cl3N2O2S — CID 171987768
N-(1,3-thiazol-2-yl)-2-(2,4,5-trichlorophenoxy)propanamide (PubChem CID 171987768) has the molecular formula C12H9Cl3N2O2S and a molecular weight of 351.64 g/mol. Its IUPAC name is N-(1,3-thiazol-2-yl)-2-(2,4,5-trichlorophenoxy)propanamide.
| Compound Name | N-(1,3-thiazol-2-yl)-2-(2,4,5-trichlorophenoxy)propanamide |
|---|---|
| PubChem CID | 171987768 |
| Molecular Formula | C12H9Cl3N2O2S |
| Molecular Weight | 351.64 g/mol |
| Exact Mass | 349.95 |
| IUPAC Name | N-(1,3-thiazol-2-yl)-2-(2,4,5-trichlorophenoxy)propanamide |
| SMILES | CC(Oc1cc(Cl)c(Cl)cc1Cl)C(=O)Nc1nccs1 |
| InChI | InChI=1S/C12H9Cl3N2O2S/c1-6(11(18)17-12-16-2-3-20-12)19-10-5-8(14)7(13)4-9(10)15/h2-6H,1H3,(H,16,17,18) |
| InChIKey | AHHAELUECOQYOQ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.64 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|