C19H19N3O4S — CID 23744805
[1-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-1-oxopropan-2-yl] 3-aminobenzoate (PubChem CID 23744805) has the molecular formula C19H19N3O4S and a molecular weight of 385.45 g/mol. Its IUPAC name is [1-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-1-oxopropan-2-yl] 3-aminobenzoate.
| Compound Name | [1-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-1-oxopropan-2-yl] 3-aminobenzoate |
|---|---|
| PubChem CID | 23744805 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | [1-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-1-oxopropan-2-yl] 3-aminobenzoate |
| SMILES | CCOc1ccc2nc(NC(=O)C(C)OC(=O)c3cccc(N)c3)sc2c1 |
| InChI | InChI=1S/C19H19N3O4S/c1-3-25-14-7-8-15-16(10-14)27-19(21-15)22-17(23)11(2)26-18(24)12-5-4-6-13(20)9-12/h4-11H,3,20H2,1-2H3,(H,21,22,23) |
| InChIKey | ITSJZCPGXVPRMY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|