C19H21N3O2S2 — CID 18894702
2-(3-aminophenyl)sulfanyl-N-(6-ethoxy-1,3-benzothiazol-2-yl)butanamide (PubChem CID 18894702) has the molecular formula C19H21N3O2S2 and a molecular weight of 387.53 g/mol. Its IUPAC name is 2-(3-aminophenyl)sulfanyl-N-(6-ethoxy-1,3-benzothiazol-2-yl)butanamide.
| Compound Name | 2-(3-aminophenyl)sulfanyl-N-(6-ethoxy-1,3-benzothiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 18894702 |
| Molecular Formula | C19H21N3O2S2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 2-(3-aminophenyl)sulfanyl-N-(6-ethoxy-1,3-benzothiazol-2-yl)butanamide |
| SMILES | CCOc1ccc2nc(NC(=O)C(CC)Sc3cccc(N)c3)sc2c1 |
| InChI | InChI=1S/C19H21N3O2S2/c1-3-16(25-14-7-5-6-12(20)10-14)18(23)22-19-21-15-9-8-13(24-4-2)11-17(15)26-19/h5-11,16H,3-4,20H2,1-2H3,(H,21,22,23) |
| InChIKey | MMQAANNYSSQEFY-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|