C13H16N4OS2 — CID 18894694
2-(3-aminophenyl)sulfanyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)butanamide (PubChem CID 18894694) has the molecular formula C13H16N4OS2 and a molecular weight of 308.43 g/mol. Its IUPAC name is 2-(3-aminophenyl)sulfanyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)butanamide.
| Compound Name | 2-(3-aminophenyl)sulfanyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 18894694 |
| Molecular Formula | C13H16N4OS2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 2-(3-aminophenyl)sulfanyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)butanamide |
| SMILES | CCC(Sc1cccc(N)c1)C(=O)Nc1nnc(C)s1 |
| InChI | InChI=1S/C13H16N4OS2/c1-3-11(20-10-6-4-5-9(14)7-10)12(18)15-13-17-16-8(2)19-13/h4-7,11H,3,14H2,1-2H3,(H,15,17,18) |
| InChIKey | KSZNYOFYXCGOGX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|