C20H20N2OS — CID 18894343
2-(3-aminophenyl)sulfanyl-N-naphthalen-1-ylbutanamide (PubChem CID 18894343) has the molecular formula C20H20N2OS and a molecular weight of 336.46 g/mol. Its IUPAC name is 2-(3-aminophenyl)sulfanyl-N-naphthalen-1-ylbutanamide.
| Compound Name | 2-(3-aminophenyl)sulfanyl-N-naphthalen-1-ylbutanamide |
|---|---|
| PubChem CID | 18894343 |
| Molecular Formula | C20H20N2OS |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 2-(3-aminophenyl)sulfanyl-N-naphthalen-1-ylbutanamide |
| SMILES | CCC(Sc1cccc(N)c1)C(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C20H20N2OS/c1-2-19(24-16-10-6-9-15(21)13-16)20(23)22-18-12-5-8-14-7-3-4-11-17(14)18/h3-13,19H,2,21H2,1H3,(H,22,23) |
| InChIKey | UYDYFRCAEUDIFX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|