C15H14ClN3O3 — CID 23860556
[1-oxo-1-(pyridin-3-ylamino)butan-2-yl] 2-chloropyridine-4-carboxylate (PubChem CID 23860556) has the molecular formula C15H14ClN3O3 and a molecular weight of 319.75 g/mol. Its IUPAC name is [1-oxo-1-(pyridin-3-ylamino)butan-2-yl] 2-chloropyridine-4-carboxylate.
| Compound Name | [1-oxo-1-(pyridin-3-ylamino)butan-2-yl] 2-chloropyridine-4-carboxylate |
|---|---|
| PubChem CID | 23860556 |
| Molecular Formula | C15H14ClN3O3 |
| Molecular Weight | 319.75 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | [1-oxo-1-(pyridin-3-ylamino)butan-2-yl] 2-chloropyridine-4-carboxylate |
| SMILES | CCC(OC(=O)c1ccnc(Cl)c1)C(=O)Nc1cccnc1 |
| InChI | InChI=1S/C15H14ClN3O3/c1-2-12(14(20)19-11-4-3-6-17-9-11)22-15(21)10-5-7-18-13(16)8-10/h3-9,12H,2H2,1H3,(H,19,20) |
| InChIKey | KVNQEGMFEOCUFB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.75 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|