C16H16ClN3O3 — CID 23972320
[1-[(3-methyl-2-pyridinyl)amino]-1-oxobutan-2-yl] 2-chloropyridine-4-carboxylate (PubChem CID 23972320) has the molecular formula C16H16ClN3O3 and a molecular weight of 333.78 g/mol. Its IUPAC name is [1-[(3-methyl-2-pyridinyl)amino]-1-oxobutan-2-yl] 2-chloropyridine-4-carboxylate.
| Compound Name | [1-[(3-methyl-2-pyridinyl)amino]-1-oxobutan-2-yl] 2-chloropyridine-4-carboxylate |
|---|---|
| PubChem CID | 23972320 |
| Molecular Formula | C16H16ClN3O3 |
| Molecular Weight | 333.78 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | [1-[(3-methyl-2-pyridinyl)amino]-1-oxobutan-2-yl] 2-chloropyridine-4-carboxylate |
| SMILES | CCC(OC(=O)c1ccnc(Cl)c1)C(=O)Nc1ncccc1C |
| InChI | InChI=1S/C16H16ClN3O3/c1-3-12(15(21)20-14-10(2)5-4-7-19-14)23-16(22)11-6-8-18-13(17)9-11/h4-9,12H,3H2,1-2H3,(H,19,20,21) |
| InChIKey | ODHOQEIJIFRHMK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.78 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|