C11H5F4NOS — CID 113291987
2-[3-fluoro-5-(trifluoromethyl)phenyl]-1,3-thiazole-5-carbaldehyde (PubChem CID 113291987) has the molecular formula C11H5F4NOS and a molecular weight of 275.23 g/mol. Its IUPAC name is 2-[3-fluoro-5-(trifluoromethyl)phenyl]-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-[3-fluoro-5-(trifluoromethyl)phenyl]-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 113291987 |
| Molecular Formula | C11H5F4NOS |
| Molecular Weight | 275.23 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | 2-[3-fluoro-5-(trifluoromethyl)phenyl]-1,3-thiazole-5-carbaldehyde |
| SMILES | O=Cc1cnc(-c2cc(F)cc(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C11H5F4NOS/c12-8-2-6(1-7(3-8)11(13,14)15)10-16-4-9(5-17)18-10/h1-5H |
| InChIKey | JGCFKAOMHZCDJK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.23 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|