C8H3Cl2NOS2 — CID 130655979
2-(2,5-dichlorothiophen-3-yl)-1,3-thiazole-5-carbaldehyde (PubChem CID 130655979) has the molecular formula C8H3Cl2NOS2 and a molecular weight of 264.16 g/mol. Its IUPAC name is 2-(2,5-dichlorothiophen-3-yl)-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-(2,5-dichlorothiophen-3-yl)-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 130655979 |
| Molecular Formula | C8H3Cl2NOS2 |
| Molecular Weight | 264.16 g/mol |
| Exact Mass | 262.90 |
| IUPAC Name | 2-(2,5-dichlorothiophen-3-yl)-1,3-thiazole-5-carbaldehyde |
| SMILES | O=Cc1cnc(-c2cc(Cl)sc2Cl)s1 |
| InChI | InChI=1S/C8H3Cl2NOS2/c9-6-1-5(7(10)14-6)8-11-2-4(3-12)13-8/h1-3H |
| InChIKey | AFGHBKFCKYTCOE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.16 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|