C11H5F4NO2S — CID 178133496
2-[2-(difluoromethoxy)-4,5-difluorophenyl]-1,3-thiazole-5-carbaldehyde (PubChem CID 178133496) has the molecular formula C11H5F4NO2S and a molecular weight of 291.23 g/mol. Its IUPAC name is 2-[2-(difluoromethoxy)-4,5-difluorophenyl]-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-[2-(difluoromethoxy)-4,5-difluorophenyl]-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 178133496 |
| Molecular Formula | C11H5F4NO2S |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | 2-[2-(difluoromethoxy)-4,5-difluorophenyl]-1,3-thiazole-5-carbaldehyde |
| SMILES | O=Cc1cnc(-c2cc(F)c(F)cc2OC(F)F)s1 |
| InChI | InChI=1S/C11H5F4NO2S/c12-7-1-6(10-16-3-5(4-17)19-10)9(2-8(7)13)18-11(14)15/h1-4,11H |
| InChIKey | OIVINIQRXTXICD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|