C9H5F2NO2S2 — CID 178133316
2-[3-(difluoromethoxy)thiophen-2-yl]-1,3-thiazole-5-carbaldehyde (PubChem CID 178133316) has the molecular formula C9H5F2NO2S2 and a molecular weight of 261.27 g/mol. Its IUPAC name is 2-[3-(difluoromethoxy)thiophen-2-yl]-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-[3-(difluoromethoxy)thiophen-2-yl]-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 178133316 |
| Molecular Formula | C9H5F2NO2S2 |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 260.97 |
| IUPAC Name | 2-[3-(difluoromethoxy)thiophen-2-yl]-1,3-thiazole-5-carbaldehyde |
| SMILES | O=Cc1cnc(-c2sccc2OC(F)F)s1 |
| InChI | InChI=1S/C9H5F2NO2S2/c10-9(11)14-6-1-2-15-7(6)8-12-3-5(4-13)16-8/h1-4,9H |
| InChIKey | JCYOARHRUJTRNC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|