C8H4BrF2NOS — CID 171547735
4-bromo-5-(difluoromethoxy)thieno[2,3-b]pyridine (PubChem CID 171547735) has the molecular formula C8H4BrF2NOS and a molecular weight of 280.09 g/mol. Its IUPAC name is 4-bromo-5-(difluoromethoxy)thieno[2,3-b]pyridine.
| Compound Name | 4-bromo-5-(difluoromethoxy)thieno[2,3-b]pyridine |
|---|---|
| PubChem CID | 171547735 |
| Molecular Formula | C8H4BrF2NOS |
| Molecular Weight | 280.09 g/mol |
| Exact Mass | 278.92 |
| IUPAC Name | 4-bromo-5-(difluoromethoxy)thieno[2,3-b]pyridine |
| SMILES | FC(F)Oc1cnc2sccc2c1Br |
| InChI | InChI=1S/C8H4BrF2NOS/c9-6-4-1-2-14-7(4)12-3-5(6)13-8(10)11/h1-3,8H |
| InChIKey | FUVPVPKIRJIFEY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.09 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |