C8H8N2OS — CID 84657451
4-methoxythieno[2,3-b]pyridin-5-amine (PubChem CID 84657451) has the molecular formula C8H8N2OS and a molecular weight of 180.23 g/mol. Its IUPAC name is 4-methoxythieno[2,3-b]pyridin-5-amine.
| Compound Name | 4-methoxythieno[2,3-b]pyridin-5-amine |
|---|---|
| PubChem CID | 84657451 |
| Molecular Formula | C8H8N2OS |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 4-methoxythieno[2,3-b]pyridin-5-amine |
| SMILES | COc1c(N)cnc2sccc12 |
| InChI | InChI=1S/C8H8N2OS/c1-11-7-5-2-3-12-8(5)10-4-6(7)9/h2-4H,9H2,1H3 |
| InChIKey | AMAUCSMTTGXSRY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |